Difference between revisions of "2.4.1.143-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * smiles: ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.143-RXN 2.4.1.143-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.143-RXN 2.4.1.143-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.4.1.143 EC-2.4.1.143] | |
− | * | + | |
− | ** 4- | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[2-N-linked-Glycan]][c] '''+''' 1 [[UDP-N-ACETYL-D-GLUCOSAMINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c] '''+''' 1 [[2-2-N-linked-Glycan]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine[c] '''+''' 1 UDP-N-acetyl-α-D-glucosamine[c] '''=>''' 1 H+[c] '''+''' 1 UDP[c] '''+''' 1 N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-7426]], mannosyl-glycoprotein N-acetylglucosaminyltransferases: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7426 PWY-7426] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12941 12941] |
− | + | * LIGAND-RXN: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07258 R07258] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-2.4.1.143}} |
− | {{#set: | + | {{#set: in pathway=PWY-7426}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:03, 21 March 2018
Contents
Reaction 2.4.1.143-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-N-linked-Glycan[c] + 1 UDP-N-ACETYL-D-GLUCOSAMINE[c] => 1 PROTON[c] + 1 UDP[c] + 1 2-2-N-linked-Glycan[c]
- With common name(s):
- 1 N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine[c] + 1 UDP-N-acetyl-α-D-glucosamine[c] => 1 H+[c] + 1 UDP[c] + 1 N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine[c]
Genes associated with this reaction
Pathways
- PWY-7426, mannosyl-glycoprotein N-acetylglucosaminyltransferases: PWY-7426
- 7 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links