Difference between revisions of "GLUCONEO-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-475...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY] ==
* smiles:
+
* taxonomic range:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
** InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA
+
** gluconeogenesis I
* molecular weight:
+
** 927.663   
+
 
* Synonym(s):
 
* Synonym(s):
** 3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-11245]]
+
'''13''' reactions found over '''13''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1.1.1.39-RXN]]
* [[RXN-11244]]
+
** 3 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-01_003680]]
 +
*** [[Ec-07_002070]]
 +
*** [[Ec-07_002060]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[2PGADEHYDRAT-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-14_005400]]
 +
*** [[Ec-27_004000]]
 +
*** [[Ec-26_004120]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[3PGAREARR-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-27_000330]]
 +
*** [[Ec-24_002670]]
 +
*** [[Ec-10_005410]]
 +
*** [[Ec-03_002160]]
 +
*** [[Ec-03_002170]]
 +
*** [[Ec-01_000980]]
 +
*** [[Ec-06_009930]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[F16ALDOLASE-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-10_004980]]
 +
*** [[Ec-01_008040]]
 +
*** [[Ec-10_000880]]
 +
*** [[Ec-14_001680]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[F16BDEPHOS-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-06_004200]]
 +
*** [[Ec-04_004710]]
 +
*** [[Ec-17_003090]]
 +
*** [[Ec-12_004070]]
 +
*** [[Ec-14_005760]]
 +
*** [[Ec-22_000360]]
 +
*** [[Ec-21_001790]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-25_003550]]
 +
*** [[Ec-19_001850]]
 +
*** [[Ec-19_003020]]
 +
*** [[Ec-08_000500]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_006200]]
 +
*** [[Ec-02_003100]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[MALIC-NADP-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_003680]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-19_002930]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PEPSYNTH-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PGLUCISOM-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-24_002470]]
 +
*** [[Ec-13_003530]]
 +
*** [[Ec-13_003810]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Ec-12_004530]]
 +
*** [[Ec-21_005710]]
 +
*** [[Ec-21_004220]]
 +
*** [[Ec-08_002400]]
 +
*** [[Ec-12_004550]]
 +
*** [[Ec-01_001350]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-08_000500]]
 +
*** [[Ec-24_000360]]
 +
*** [[Ec-03_002790]]
 +
*** [[Ec-23_004160]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173446 46173446]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
* CHEBI:
+
* ARACYC:
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73549 73549]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-4751}}
{{#set: inchi key=InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J}}
+
{{#set: taxonomic range=TAX-33090}}
{{#set: common name=3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA}}
+
{{#set: taxonomic range=TAX-2157}}
{{#set: molecular weight=927.663    }}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA}}
+
{{#set: common name=gluconeogenesis I}}
{{#set: consumed by=RXN-11245}}
+
{{#set: reaction found=13}}
{{#set: produced by=RXN-11244}}
+
{{#set: total reaction=13}}
 +
{{#set: completion rate=100.0}}

Latest revision as of 19:12, 21 March 2018

Pathway GLUCONEO-PWY

Reaction(s) found

13 reactions found over 13 reactions in the full pathway

Reaction(s) not found

External links