Difference between revisions of "Ec-04 004280"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1...")
(Created page with "Category:Gene == Gene Ec-04_004280 == * left end position: ** 4302320 * transcription direction: ** NEGATIVE * right end position: ** 4304134 * centisome position: ** 66.0...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] ==
+
== Gene Ec-04_004280 ==
* smiles:
+
* left end position:
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** 4302320
* inchi key:
+
* transcription direction:
** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
+
** NEGATIVE
* common name:
+
* right end position:
** 8-oxo-GTP
+
** 4304134
* molecular weight:
+
* centisome position:
** 535.151    
+
** 66.06908    
 
* Synonym(s):
 
* Synonym(s):
** 8-oxo-guanosine-triphosphate
+
** Esi_0044_0067
 +
** Esi0044_0067
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RIBOFLAVINKIN-RXN]]
* [[RXN-11409]]
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY66-366]]
 +
* [[PWY-6168]]
 +
* [[RIBOSYN2-PWY]]
 +
* [[PWY-5523]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=4302320}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: right end position=4304134}}
{{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}}
+
{{#set: centisome position=66.06908   }}
{{#set: common name=8-oxo-GTP}}
+
{{#set: common name=Esi_0044_0067|Esi0044_0067}}
{{#set: molecular weight=535.151   }}
+
{{#set: reaction associated=RIBOFLAVINKIN-RXN}}
{{#set: common name=8-oxo-guanosine-triphosphate}}
+
{{#set: pathway associated=PWY66-366|PWY-6168|RIBOSYN2-PWY|PWY-5523}}
{{#set: produced by=RXN-11409}}
+

Latest revision as of 19:05, 21 March 2018

Gene Ec-04_004280

  • left end position:
    • 4302320
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4304134
  • centisome position:
    • 66.06908
  • Synonym(s):
    • Esi_0044_0067
    • Esi0044_0067

Reactions associated

Pathways associated

External links