Difference between revisions of "PWY-5497"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
−
* inchi key:
+
−
** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
−
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
+
** purine nucleobases degradation II (anaerobic)
−
* molecular weight:
+
−
** 444.74   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** purine fermentation
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-12]]
+
'''8''' reactions found over '''24''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[FORMYLTHFDEFORMYL-RXN]]
−
* [[RXN66-11]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GLYOHMETRANS-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-14_004260]]
 +
*** [[Ec-24_002640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[METHENYLTHFCYCLOHYDRO-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-14_004070]]
 +
*** [[Ec-15_001370]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-15_001370]]
 +
*** [[Ec-14_004070]]
 +
*** [[Ec-07_007470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-18_003420]]
 +
*** [[Ec-15_004230]]
 +
*** [[Ec-23_002710]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15124]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15127]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-901]]
 +
** 2 associated gene(s):
 +
*** [[Ec-20_000230]]
 +
*** [[Ec-20_000210]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.2-RXN 1.2.1.2-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=4.3.1.4-RXN 4.3.1.4-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ACETATEKIN-RXN ACETATEKIN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE-FORMIMINOTRANSFERASE-RXN GLYCINE-FORMIMINOTRANSFERASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GUANINE-DEAMINASE-RXN GUANINE-DEAMINASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PHOSACETYLTRANS-RXN PHOSACETYLTRANS-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R127-RXN R127-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R128-RXN R128-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R13-RXN R13-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R62-RXN R62-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R63-RXN R63-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15125 RXN-15125]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8751 RXN-8751]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8752 RXN-8752]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8753 RXN-8753]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8754 RXN-8754]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1239}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201302 25201302]
+
{{#set: common name=purine nucleobases degradation II (anaerobic)}}
−
* HMDB : HMDB12160
+
{{#set: common name=purine fermentation}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: reaction found=8}}
−
{{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}}
+
{{#set: total reaction=24}}
−
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: completion rate=33.0}}
−
{{#set: molecular weight=444.74    }}
+
−
{{#set: consumed by=RXN66-12}}
+
−
{{#set: produced by=RXN66-11}}
+

Latest revision as of 19:05, 21 March 2018

Pathway PWY-5497

  • taxonomic range:
  • common name:
    • purine nucleobases degradation II (anaerobic)
  • Synonym(s):
    • purine fermentation

Reaction(s) found

8 reactions found over 24 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5497&oldid=24442"