Difference between revisions of "PWY-7618"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ERYTHRO-IMIDAZOLE-GLYCEROL-P D-ERYTHRO-IMIDAZOLE-GLYCEROL-P] == * smiles: ** C1(NC=NC=1C(C(O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7618 PWY-7618] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ERYTHRO-IMIDAZOLE-GLYCEROL-P D-ERYTHRO-IMIDAZOLE-GLYCEROL-P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7618 PWY-7618] ==
* smiles:
+
* taxonomic range:
** C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=HFYBTHCYPKEDQQ-RITPCOANSA-L
+
 
* common name:
 
* common name:
** D-erythro-imidazole-glycerol-phosphate
+
** ricinoleate biosynthesis
* molecular weight:
+
** 236.121   
+
 
* Synonym(s):
 
* Synonym(s):
** D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate
 
** D-erythro-imidazole-glycerol-P
 
** erythro-imidazole-glycerol-P
 
** erythro-imidazole-glycerol-phosphate
 
** imidazole glycerol phosphate
 
** IGP
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[IMIDPHOSDEHYD-RXN]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-16151]]
* [[GLUTAMIDOTRANS-RXN]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-16_002160]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9670]]
 +
** 1 associated gene(s):
 +
*** [[Ec-16_002160]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16148 RXN-16148]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459954 5459954]
+
{{#set: common name=ricinoleate biosynthesis}}
* HMDB : HMDB12208
+
{{#set: reaction found=2}}
* LIGAND-CPD:
+
{{#set: total reaction=3}}
** [http://www.genome.jp/dbget-bin/www_bget?C04666 C04666]
+
{{#set: completion rate=67.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4573672.html 4573672]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58278 58278]
+
* BIGG : 44288
+
{{#set: smiles=C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)}}
+
{{#set: inchi key=InChIKey=HFYBTHCYPKEDQQ-RITPCOANSA-L}}
+
{{#set: common name=D-erythro-imidazole-glycerol-phosphate}}
+
{{#set: molecular weight=236.121    }}
+
{{#set: common name=D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate|D-erythro-imidazole-glycerol-P|erythro-imidazole-glycerol-P|erythro-imidazole-glycerol-phosphate|imidazole glycerol phosphate|IGP}}
+
{{#set: consumed by=IMIDPHOSDEHYD-RXN}}
+
{{#set: produced by=GLUTAMIDOTRANS-RXN}}
+

Latest revision as of 19:06, 21 March 2018

Pathway PWY-7618

  • taxonomic range:
  • common name:
    • ricinoleate biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links