Difference between revisions of "Ec-24 004110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
(Created page with "Category:Gene == Gene Ec-24_004110 == * left end position: ** 4545066 * transcription direction: ** NEGATIVE * right end position: ** 4549002 * centisome position: ** 91.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_004110 == |
− | * | + | * left end position: |
− | ** | + | ** 4545066 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4549002 |
− | * | + | * centisome position: |
− | ** | + | ** 91.126 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0109_0038 |
− | ** | + | ** Esi0109_0038 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4545066}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4549002}} | |
− | + | {{#set: centisome position=91.126 }} | |
− | + | {{#set: common name=Esi_0109_0038|Esi0109_0038}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:06, 21 March 2018
Gene Ec-24_004110
- left end position:
- 4545066
- transcription direction:
- NEGATIVE
- right end position:
- 4549002
- centisome position:
- 91.126
- Synonym(s):
- Esi_0109_0038
- Esi0109_0038
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome