Difference between revisions of "Ec-25 000510"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...")
(Created page with "Category:Gene == Gene Ec-25_000510 == * left end position: ** 614281 * transcription direction: ** NEGATIVE * right end position: ** 642150 * centisome position: ** 13.801...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] ==
+
== Gene Ec-25_000510 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 614281
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** cathasterone
+
** 642150
−
* molecular weight:
+
* centisome position:
−
** 432.685    
+
** 13.801159    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0302_0017
 +
** Esi0302_0017
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
* [[RXN-715]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=614281}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203118 25203118]
+
{{#set: transcription direction=NEGATIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=642150}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790]
+
{{#set: centisome position=13.801159    }}
−
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: common name=Esi_0302_0017|Esi0302_0017}}
−
{{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}}
+
{{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: common name=cathasterone}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: molecular weight=432.685    }}
+
−
{{#set: produced by=RXN-715}}
+

Latest revision as of 19:06, 21 March 2018

Gene Ec-25_000510

  • left end position:
    • 614281
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 642150
  • centisome position:
    • 13.801159
  • Synonym(s):
    • Esi_0302_0017
    • Esi0302_0017

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-25_000510&oldid=24620"