Difference between revisions of "CU+"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * inchi key: ** InChIKey=PMOW...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CU+ CU+] == * smiles: ** [Cu+] * inchi key: ** InChIKey=VMQMZMRVKUZKQL-UHFFFAOYSA-N * common na...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CU+ CU+] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [Cu+] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VMQMZMRVKUZKQL-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** Cu+ |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 63.546 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Cu(I) |
| + | ** cuprous ion | ||
| + | ** cuprous copper | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TransportSeed_CU+]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TransportSeed_CU+]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ExchangeSeed_CU+]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=104815 104815] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.94614.html 94614] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49552 49552] |
| − | * | + | * BIGG : 2323762 |
| − | {{#set: smiles= | + | {{#set: smiles=[Cu+]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=VMQMZMRVKUZKQL-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=Cu+}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=63.546 }} |
| − | {{#set: common name= | + | {{#set: common name=Cu(I)|cuprous ion|cuprous copper}} |
| − | {{#set: consumed by= | + | {{#set: consumed by=TransportSeed_CU+}} |
| − | {{#set: produced by= | + | {{#set: produced by=TransportSeed_CU+}} |
| + | {{#set: reversible reaction associated=ExchangeSeed_CU+}} | ||
Latest revision as of 19:07, 21 March 2018
Contents
Metabolite CU+
- smiles:
- [Cu+]
- inchi key:
- InChIKey=VMQMZMRVKUZKQL-UHFFFAOYSA-N
- common name:
- Cu+
- molecular weight:
- 63.546
- Synonym(s):
- Cu(I)
- cuprous ion
- cuprous copper
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
