Difference between revisions of "PWY-5070"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] == * smiles: ** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5070 PWY-5070] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5070 PWY-5070] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J
+
 
* common name:
 
* common name:
−
** (S)-3-hydroxy-(7Z)-tetradecenoyl-CoA
+
** gibberellin biosynthesis I (non C-3, non C-13 hydroxylation)
−
* molecular weight:
+
−
** 987.845   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-14:1-Δ7-CoA
+
** gibberellin biosynthesis I (late C-3 hydroxylation)
−
** (S)-3-hydroxy-7-cis-tetradecenoyl-CoA
+
** gibberellin biosynthesis I (late C-13 hydroxylation)
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-17794]]
+
'''3''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN1F-162]]
−
* [[RXN-17793]]
+
** 3 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-19_002750]]
 +
*** [[Ec-08_003510]]
 +
*** [[Ec-19_002760]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN1F-163]]
 +
** 3 associated gene(s):
 +
*** [[Ec-08_003510]]
 +
*** [[Ec-19_002750]]
 +
*** [[Ec-19_002760]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN1F-165]]
 +
** 3 associated gene(s):
 +
*** [[Ec-19_002750]]
 +
*** [[Ec-19_002760]]
 +
*** [[Ec-08_003510]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6523 RXN-6523]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6541 RXN-6541]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-164 RXN1F-164]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-99 RXN1F-99]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* ARACYC:
−
{{#set: inchi key=InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J}}
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5070 PWY-5070]
−
{{#set: common name=(S)-3-hydroxy-(7Z)-tetradecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: molecular weight=987.845    }}
+
{{#set: common name=gibberellin biosynthesis I (non C-3, non C-13 hydroxylation)}}
−
{{#set: common name=(S)-3-hydroxy-14:1-Δ7-CoA|(S)-3-hydroxy-7-cis-tetradecenoyl-CoA}}
+
{{#set: common name=gibberellin biosynthesis I (late C-3 hydroxylation)|gibberellin biosynthesis I (late C-13 hydroxylation)}}
−
{{#set: consumed by=RXN-17794}}
+
{{#set: reaction found=3}}
−
{{#set: produced by=RXN-17793}}
+
{{#set: total reaction=7}}
 +
{{#set: completion rate=43.0}}

Latest revision as of 19:08, 21 March 2018

Pathway PWY-5070

  • taxonomic range:
  • common name:
    • gibberellin biosynthesis I (non C-3, non C-13 hydroxylation)
  • Synonym(s):
    • gibberellin biosynthesis I (late C-3 hydroxylation)
    • gibberellin biosynthesis I (late C-13 hydroxylation)

Reaction(s) found

3 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5070&oldid=24791"