Difference between revisions of "Oxidized-2Fe-2S-Ferredoxins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * smiles: ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) * inchi key: **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-2Fe-2S-Ferredoxins Oxidized-2Fe-2S-Ferredoxins] == * common name: ** an oxidized [2Fe-...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-2Fe-2S-Ferredoxins Oxidized-2Fe-2S-Ferredoxins] ==
* smiles:
+
** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)
+
* inchi key:
+
** InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
+
** an oxidized [2Fe-2S] ferredoxin
* molecular weight:
+
** 222.177   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10722]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.8.1.6-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-10721]]
+
* [[RXN-17472]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an oxidized [2Fe-2S] ferredoxin}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145116 21145116]
+
{{#set: produced by=2.8.1.6-RXN}}
* CHEMSPIDER:
+
{{#set: reversible reaction associated=RXN-17472}}
** [http://www.chemspider.com/Chemical-Structure.20016009.html 20016009]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05645 C05645]
+
* HMDB : HMDB04083
+
{{#set: smiles=C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)}}
+
{{#set: inchi key=InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M}}
+
{{#set: common name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}}
+
{{#set: molecular weight=222.177    }}
+
{{#set: consumed by=RXN-10722}}
+
{{#set: reversible reaction associated=RXN-10721}}
+

Latest revision as of 19:09, 21 March 2018

Metabolite Oxidized-2Fe-2S-Ferredoxins

  • common name:
    • an oxidized [2Fe-2S] ferredoxin
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an oxidized [2Fe-2S] ferredoxin" cannot be used as a page name in this wiki.