Difference between revisions of "S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(C(NC(CCC([N+])C([O-])=O)=O)C(=O)NCC([O-])=O)SC=O * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == * smiles: **...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N |
* common name: | * common name: | ||
− | ** S- | + | ** S-adenosyl-4-methylthio-2-oxobutanoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 397.405 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[DAPASYN-RXN]] |
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459852 5459852] |
− | * | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.4573603.html 4573603] | |
− | ** [http://www. | + | |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16490 16490] |
− | * | + | * BIGG : 43797 |
− | {{#set: smiles=C | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04425 C04425] |
− | {{#set: common name=S- | + | {{#set: smiles=C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N}} |
− | + | {{#set: common name=S-adenosyl-4-methylthio-2-oxobutanoate}} | |
− | + | {{#set: molecular weight=397.405 }} | |
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=DAPASYN-RXN}} |
Latest revision as of 19:09, 21 March 2018
Contents
Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE
- smiles:
- C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))
- inchi key:
- InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N
- common name:
- S-adenosyl-4-methylthio-2-oxobutanoate
- molecular weight:
- 397.405
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))" cannot be used as a page name in this wiki.