Difference between revisions of "PWY-5698"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5698 PWY-5698] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5698 PWY-5698] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** allantoin degradation to ureidoglycolate II (ammonia producing) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
− | * [[ | + | * [[ALLANTOINASE-RXN]] |
− | == Reaction(s) | + | ** 0 associated gene: |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE-DEIMINASE-RXN ALLANTOATE-DEIMINASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=URUR-RXN URUR-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5698 PWY-5698] |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=allantoin degradation to ureidoglycolate II (ammonia producing)}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:09, 21 March 2018
Pathway PWY-5698
- taxonomic range:
- common name:
- allantoin degradation to ureidoglycolate II (ammonia producing)
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- ALLANTOINASE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: