Difference between revisions of "GUANOSINE-5DP-3DP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-27_001950 == * left end position: ** 1652132 * transcription direction: ** POSITIVE * right end position: ** 1661607 * centisome position: ** 25.6...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * smiles: ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-27_001950 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
−
* left end position:
+
* smiles:
−
** 1652132
+
** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)([O-])[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
−
* right end position:
+
* common name:
−
** 1661607
+
** ppGpp
−
* centisome position:
+
* molecular weight:
−
** 25.614819    
+
** 598.123    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0036_0051
+
** guanosine tetraphosphate
−
** Esi0036_0051
+
** guanosine 5'-diphosphate,3'-diphosphate
 +
** guanosine 3',5'-bispyrophosphate
 +
** guanosine 3',5'-bis(diphosphate)
 +
** guanosine 3'-diphosphate 5'-diphosphate
 +
** magic spot
 +
** guanosine-5',3'-tetraphosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[RXN0-2381]]
+
== Reaction(s) known to produce the compound ==
−
** Source: [[annotation-esiliculosus_genome]]
+
* [[GDPPYPHOSKIN-RXN]]
−
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
−
* Reaction: [[RXN0-2382]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: ec-number
+
−
* Reaction: [[TRYPSYN-RXN]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: ec-number
+
−
** Source: [[orthology-aragem]]
+
−
== Pathways associated ==
+
−
* [[TRPSYN-PWY]]
+
−
* [[PWY-6949]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1652132}}
+
* DRUGBANK : DB04022
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=1661607}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15938967 15938967]
−
{{#set: centisome position=25.614819   }}
+
* HMDB : HMDB59638
−
{{#set: common name=Esi_0036_0051|Esi0036_0051}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=RXN0-2381|RXN0-2382|TRYPSYN-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01228 C01228]
−
{{#set: pathway associated=TRPSYN-PWY|PWY-6949}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.13082026.html 13082026]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77828 77828]
 +
* BIGG : 37137
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)([O-])[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
 +
{{#set: inchi key=InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I}}
 +
{{#set: common name=ppGpp}}
 +
{{#set: molecular weight=598.123   }}
 +
{{#set: common name=guanosine tetraphosphate|guanosine 5'-diphosphate,3'-diphosphate|guanosine 3',5'-bispyrophosphate|guanosine 3',5'-bis(diphosphate)|guanosine 3'-diphosphate 5'-diphosphate|magic spot|guanosine-5',3'-tetraphosphate}}
 +
{{#set: produced by=GDPPYPHOSKIN-RXN}}

Latest revision as of 19:10, 21 March 2018

Metabolite GUANOSINE-5DP-3DP

  • smiles:
    • C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)([O-])[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))
  • inchi key:
    • InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
  • common name:
    • ppGpp
  • molecular weight:
    • 598.123
  • Synonym(s):
    • guanosine tetraphosphate
    • guanosine 5'-diphosphate,3'-diphosphate
    • guanosine 3',5'-bispyrophosphate
    • guanosine 3',5'-bis(diphosphate)
    • guanosine 3'-diphosphate 5'-diphosphate
    • magic spot
    • guanosine-5',3'-tetraphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)([O-])[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GUANOSINE-5DP-3DP&oldid=24988"