Difference between revisions of "PWY-5285"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == * smiles: ** C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=HEBKCHPVOIAQTA-ZXF...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5285 PWY-5285] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5285 PWY-5285] ==
* smiles:
+
* taxonomic range:
** C(O)C(O)C(O)C(O)CO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
* inchi key:
+
** InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N
+
 
* common name:
 
* common name:
** ribitol
+
** sulfide oxidation III (persulfide dioxygenase)
* molecular weight:
+
** 152.147   
+
 
* Synonym(s):
 
* Synonym(s):
** meso-ribitol
 
** adonitol
 
** (2R,3s,4S)-pentane-1,2,3,4,5-pentol
 
** D-ribitol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-15348]]
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=FESGSHTHIO-RXN FESGSHTHIO-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16574 RXN-16574]
 
== External links  ==
 
== External links  ==
* CAS : 488-81-3
+
{{#set: taxonomic range=TAX-1224}}
* LIGAND-CPD:
+
{{#set: common name=sulfide oxidation III (persulfide dioxygenase)}}
** [http://www.genome.jp/dbget-bin/www_bget?C00474 C00474]
+
{{#set: reaction found=1}}
* CHEBI:
+
{{#set: total reaction=3}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15963 15963]
+
{{#set: completion rate=33.0}}
* METABOLIGHTS : MTBLC15963
+
* HMDB : HMDB00508
+
{{#set: smiles=C(O)C(O)C(O)C(O)CO}}
+
{{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N}}
+
{{#set: common name=ribitol}}
+
{{#set: molecular weight=152.147    }}
+
{{#set: common name=meso-ribitol|adonitol|(2R,3s,4S)-pentane-1,2,3,4,5-pentol|D-ribitol}}
+
{{#set: consumed or produced by=RIBITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:13, 21 March 2018

Pathway PWY-5285

  • taxonomic range:
  • common name:
    • sulfide oxidation III (persulfide dioxygenase)
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links