Difference between revisions of "CPD-16483"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16483 CPD-16483] == * smiles: ** CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16483 CPD-16483] == |
* smiles: | * smiles: | ||
− | ** CC(= | + | ** CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-15271]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: smiles=CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)}} | |
− | + | {{#set: common name=α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R}} | |
− | + | {{#set: produced by=RXN-15271}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: smiles=CC(= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-16483
- smiles:
- CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)
- common name:
- α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)" cannot be used as a page name in this wiki.