Difference between revisions of "Ec-14 005260"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NOREPINEPHRINE NOREPINEPHRINE] == * smiles: ** C1(C=C(O)C(=CC=1C(C[N+])O)O) * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Ec-14_005260 == * left end position: ** 4846153 * transcription direction: ** NEGATIVE * right end position: ** 4853916 * centisome position: ** 73.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-14_005260 == |
− | * | + | * left end position: |
− | ** | + | ** 4846153 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4853916 |
− | * | + | * centisome position: |
− | ** | + | ** 73.86947 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0100_0085 |
− | ** | + | ** Esi0100_0085 |
− | ** | + | ** NIN-like 4 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | == | + | * Reaction: [[RIBOFLAVINKIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
+ | == Pathways associated == | ||
+ | * [[PWY66-366]] | ||
+ | * [[PWY-6168]] | ||
+ | * [[RIBOSYN2-PWY]] | ||
+ | * [[PWY-5523]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4846153}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4853916}} | |
− | + | {{#set: centisome position=73.86947 }} | |
− | + | {{#set: common name=Esi_0100_0085|Esi0100_0085|NIN-like 4}} | |
− | + | {{#set: reaction associated=RIBOFLAVINKIN-RXN}} | |
− | + | {{#set: pathway associated=PWY66-366|PWY-6168|RIBOSYN2-PWY|PWY-5523}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:11, 21 March 2018
Gene Ec-14_005260
- left end position:
- 4846153
- transcription direction:
- NEGATIVE
- right end position:
- 4853916
- centisome position:
- 73.86947
- Synonym(s):
- Esi_0100_0085
- Esi0100_0085
- NIN-like 4
Reactions associated
- Reaction: RIBOFLAVINKIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome