Difference between revisions of "Ec-25 003070"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * smiles: ** C(OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inch...") |
(Created page with "Category:Gene == Gene Ec-25_003070 == * left end position: ** 3414725 * transcription direction: ** NEGATIVE * right end position: ** 3444992 * centisome position: ** 76.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-25_003070 == |
− | * | + | * left end position: |
− | ** | + | ** 3414725 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3444992 |
− | * | + | * centisome position: |
− | ** | + | ** 76.71922 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0268_0018 |
− | ** | + | ** Esi0268_0018 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * | + | *** Assignment: go-term |
− | + | == Pathways associated == | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3414725}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3444992}} | |
− | + | {{#set: centisome position=76.71922 }} | |
− | + | {{#set: common name=Esi_0268_0018|Esi0268_0018}} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:12, 21 March 2018
Gene Ec-25_003070
- left end position:
- 3414725
- transcription direction:
- NEGATIVE
- right end position:
- 3444992
- centisome position:
- 76.71922
- Synonym(s):
- Esi_0268_0018
- Esi0268_0018
Reactions associated
- Reaction: DNA-DIRECTED-RNA-POLYMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome