Difference between revisions of "ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN] == * direction: ** REVER...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** aldehyde dehydrogenase [NAD(P)+] |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1.5 EC-1.2.1.5] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Aldehydes]][c] '''<=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[Carboxylates]][c] '''+''' 2 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 NAD(P)+[c] '''+''' 1 H2O[c] '''+''' 1 an aldehyde[c] '''<=>''' 1 NAD(P)H[c] '''+''' 1 a carboxylate[c] '''+''' 2 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-11_002450]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P30838 P30838] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P51647 P51647] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P47771 P47771] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: common name=aldehyde dehydrogenase [NAD(P)+]}} |
− | {{#set: | + | {{#set: ec number=EC-1.2.1.5}} |
+ | {{#set: gene associated=Ec-11_002450}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:13, 21 March 2018
Contents
Reaction ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN
- direction:
- REVERSIBLE
- common name:
- aldehyde dehydrogenase [NAD(P)+]
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD-P-OR-NOP[c] + 1 WATER[c] + 1 Aldehydes[c] <=> 1 NADH-P-OR-NOP[c] + 1 Carboxylates[c] + 2 PROTON[c]
- With common name(s):
- 1 NAD(P)+[c] + 1 H2O[c] + 1 an aldehyde[c] <=> 1 NAD(P)H[c] + 1 a carboxylate[c] + 2 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-11_002450
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
"aldehyde dehydrogenase [NAD(P)+" cannot be used as a page name in this wiki.