Difference between revisions of "CPD-15172"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-881 RXN1G-881] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta17-3-oxo-C36:1-[ac...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-881 RXN1G-881] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
 +
* inchi key:
 +
** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** cis-delta17-3-oxo-C36:1-[acyl-carrier protein] reductase
+
** 6,7-dehydrobaicalein
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9]
+
** 268.225   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[cis-delta17-3-oxo-C36-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[cis-delta17-3-hydroxyC36-ACPs]][c]
+
* [[RXN-14240]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a cis-delta17-3-oxo-C36:1-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a cis-delta17-3-hydroxyC36:1-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''30''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=cis-delta17-3-oxo-C36:1-[acyl-carrier protein] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952]
−
{{#set: ec number=EC-1.1.1.M9}}
+
{{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}}
−
{{#set: in pathway=PWYG-321}}
+
{{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=6,7-dehydrobaicalein}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=268.225    }}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: produced by=RXN-14240}}

Latest revision as of 19:13, 21 March 2018

Metabolite CPD-15172

  • smiles:
    • C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
  • inchi key:
    • InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
  • common name:
    • 6,7-dehydrobaicalein
  • molecular weight:
    • 268.225
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-15172&oldid=25409"