Difference between revisions of "1.14.21.6-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.21.6-RXN 1.14.21.6-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Fatty acid hydroxyl...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.21.6-RXN 1.14.21.6-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Fatty acid hydroxylase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-4186]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''=>''' 2 [[WATER]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[CPD-4187]][c] |
− | = | + | * With common name(s): |
+ | ** 1 lathosterol[c] '''+''' 1 oxygen[c] '''+''' 2 H+[c] '''+''' 2 a ferrocytochrome b5[c] '''=>''' 2 H2O[c] '''+''' 2 a ferricytochrome b5[c] '''+''' 1 7-dehydrocholesterol[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-01_003780]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341] | ||
+ | ** '''9''' reactions found over '''22''' reactions in the full pathway | ||
+ | * [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3] | ||
+ | ** '''9''' reactions found over '''22''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18924 18924] | |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18920 18920] |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07215 R07215] | |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | * | + | {{#set: common name=Fatty acid hydroxylase}} |
− | ** [http://www. | + | {{#set: ec number=EC-1.14.19.20}} |
− | + | {{#set: gene associated=Ec-01_003780}} | |
− | + | {{#set: in pathway=PWY66-341|PWY66-3}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:13, 21 March 2018
Contents
Reaction 1.14.21.6-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Fatty acid hydroxylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-4186[c] + 1 OXYGEN-MOLECULE[c] + 2 PROTON[c] + 2 FERROCYTOCHROME-B5[c] => 2 WATER[c] + 2 FERRICYTOCHROME-B5[c] + 1 CPD-4187[c]
- With common name(s):
- 1 lathosterol[c] + 1 oxygen[c] + 2 H+[c] + 2 a ferrocytochrome b5[c] => 2 H2O[c] + 2 a ferricytochrome b5[c] + 1 7-dehydrocholesterol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-01_003780
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY66-341, cholesterol biosynthesis I: PWY66-341
- 9 reactions found over 22 reactions in the full pathway
- PWY66-3, cholesterol biosynthesis II (via 24,25-dihydrolanosterol): PWY66-3
- 9 reactions found over 22 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links