Difference between revisions of "KDPGALDOL-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KDPGALDOL-RXN KDPGALDOL-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** KDPG/KHG aldolase *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KDPGALDOL-RXN KDPGALDOL-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** KDPG/KHG aldolase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.1.2.55 EC-4.1.2.55] |
+ | ** [http://enzyme.expasy.org/EC/4.1.2.14 EC-4.1.2.14] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[2-KETO-3-DEOXY-6-P-GLUCONATE]][c] '''=>''' 1 [[GAP]][c] '''+''' 1 [[PYRUVATE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 2-dehydro-3-deoxy-D-gluconate 6-phosphate[c] '''=>''' 1 D-glyceraldehyde 3-phosphate[c] '''+''' 1 pyruvate[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Ec-27_004070]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-2221]], Entner-Doudoroff pathway III (semi-phosphorylative): [http://metacyc.org/META/NEW-IMAGE?object=PWY-2221 PWY-2221] | ||
+ | ** '''5''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-7310]], D-glucosaminate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7310 PWY-7310] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-6507]], 4-deoxy-L-threo-hex-4-enopyranuronate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6507 PWY-6507] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[GALACTUROCAT-PWY]], D-galacturonate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GALACTUROCAT-PWY GALACTUROCAT-PWY] | ||
+ | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[ENTNER-DOUDOROFF-PWY]], Entner-Doudoroff pathway I: [http://metacyc.org/META/NEW-IMAGE?object=ENTNER-DOUDOROFF-PWY ENTNER-DOUDOROFF-PWY] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-7562]], 3,6-anhydro-α-L-galactopyranose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7562 PWY-7562] | ||
+ | ** '''1''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-7242]], D-fructuronate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7242 PWY-7242] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17089 17089] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05605 R05605] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P44480 P44480] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A955 P0A955] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P00885 P00885] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JR44 Q9JR44] |
− | + | ** [http://www.uniprot.org/uniprot/O25729 O25729] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9ZKB4 Q9ZKB4] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/O83578 O83578] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9WXS1 Q9WXS1] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P50846 P50846] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P38448 P38448] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q55872 Q55872] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P94802 P94802] |
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=KDPG/KHG aldolase}} | ||
+ | {{#set: ec number=EC-4.1.2.55}} | ||
+ | {{#set: ec number=EC-4.1.2.14}} | ||
+ | {{#set: gene associated=Ec-27_004070}} | ||
+ | {{#set: in pathway=PWY-2221|PWY-7310|PWY-6507|GALACTUROCAT-PWY|ENTNER-DOUDOROFF-PWY|PWY-7562|PWY-7242}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:13, 21 March 2018
Contents
Reaction KDPGALDOL-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- KDPG/KHG aldolase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-KETO-3-DEOXY-6-P-GLUCONATE[c] => 1 GAP[c] + 1 PYRUVATE[c]
- With common name(s):
- 1 2-dehydro-3-deoxy-D-gluconate 6-phosphate[c] => 1 D-glyceraldehyde 3-phosphate[c] + 1 pyruvate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_004070
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-2221, Entner-Doudoroff pathway III (semi-phosphorylative): PWY-2221
- 5 reactions found over 9 reactions in the full pathway
- PWY-7310, D-glucosaminate degradation: PWY-7310
- 1 reactions found over 3 reactions in the full pathway
- PWY-6507, 4-deoxy-L-threo-hex-4-enopyranuronate degradation: PWY-6507
- 2 reactions found over 5 reactions in the full pathway
- GALACTUROCAT-PWY, D-galacturonate degradation I: GALACTUROCAT-PWY
- 1 reactions found over 5 reactions in the full pathway
- ENTNER-DOUDOROFF-PWY, Entner-Doudoroff pathway I: ENTNER-DOUDOROFF-PWY
- 2 reactions found over 2 reactions in the full pathway
- PWY-7562, 3,6-anhydro-α-L-galactopyranose degradation: PWY-7562
- 1 reactions found over 7 reactions in the full pathway
- PWY-7242, D-fructuronate degradation: PWY-7242
- 1 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: