Difference between revisions of "CELLOBIOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] == * smiles: ** C(NC1(NC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * inchi...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N |
* common name: | * common name: | ||
− | ** | + | ** β-D-cellobiose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 342.299 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4-O-β-D-glucopyranosyl-β-D-glucopyranose |
− | ** | + | ** β-D-glucosyl-(1→4)-β-D-glucose |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10773]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 528-50-7 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10712 10712] | ||
+ | * HMDB : HMDB00055 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06422 C06422] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10261.html 10261] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36217 36217] |
− | + | {{#set: smiles=C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O}} | |
− | + | {{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N}} | |
− | + | {{#set: common name=β-D-cellobiose}} | |
− | + | {{#set: molecular weight=342.299 }} | |
− | {{#set: smiles=C( | + | {{#set: common name=4-O-β-D-glucopyranosyl-β-D-glucopyranose|β-D-glucosyl-(1→4)-β-D-glucose}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-10773}} |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + | |
− | + |
Latest revision as of 19:13, 21 March 2018
Contents
Metabolite CELLOBIOSE
- smiles:
- C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O
- inchi key:
- InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N
- common name:
- β-D-cellobiose
- molecular weight:
- 342.299
- Synonym(s):
- 4-O-β-D-glucopyranosyl-β-D-glucopyranose
- β-D-glucosyl-(1→4)-β-D-glucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links