Difference between revisions of "Ec-13 000610"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...")
(Created page with "Category:Gene == Gene Ec-13_000610 == * Synonym(s): ** Esi_0191_0069 ** Esi0191_0069 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] ==
+
== Gene Ec-13_000610 ==
−
* smiles:
+
−
** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
+
−
* inchi key:
+
−
** InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
+
−
* common name:
+
−
** strictosidine
+
−
* molecular weight:
+
−
** 531.581   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-α(S)-strictosidine
+
** Esi_0191_0069
 +
** Esi0191_0069
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8443]]
−
* [[STRICTOSIDINE-SYNTHASE-RXN]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* CAS : 20824-29-7
+
{{#set: common name=Esi_0191_0069|Esi0191_0069}}
−
* PUBCHEM:
+
{{#set: reaction associated=RXN-8443}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123291 44123291]
+
{{#set: pathway associated=PWY-5381}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470]
+
−
{{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}}
+
−
{{#set: inchi key=InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O}}
+
−
{{#set: common name=strictosidine}}
+
−
{{#set: molecular weight=531.581    }}
+
−
{{#set: common name=3-α(S)-strictosidine}}
+
−
{{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}}
+

Latest revision as of 19:13, 21 March 2018

Gene Ec-13_000610

  • Synonym(s):
    • Esi_0191_0069
    • Esi0191_0069

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_000610&oldid=25452"