Difference between revisions of "PRISTANATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-03_000050 == * Synonym(s): ** Esi_0523_0002 ** Esi0523_0002 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == |
+ | * smiles: | ||
+ | ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** pristanate | ||
+ | * molecular weight: | ||
+ | ** 297.5 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** pristanic-acid |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN66-484]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849056 20849056] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.20171482.html 20171482] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77268 77268] | ||
+ | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=pristanate}} | ||
+ | {{#set: molecular weight=297.5 }} | ||
+ | {{#set: common name=pristanic-acid}} | ||
+ | {{#set: consumed by=RXN66-484}} |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite PRISTANATE
- smiles:
- CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C
- inchi key:
- InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M
- common name:
- pristanate
- molecular weight:
- 297.5
- Synonym(s):
- pristanic-acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C" cannot be used as a page name in this wiki.