Difference between revisions of "PWY-2781"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * smiles: ** C(C(=O)[O-])N(C)C(N)=[N+] * inchi key: ** InChIKey=CVSVTCORW...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2781 PWY-2781] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2781 PWY-2781] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cis-zeatin biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cis-cytokinins biosynthesis |
− | + | ** tRNA-dependent cytokinin biosynthesis | |
− | ** | + | |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''5''' reactions in the full pathway |
− | + | * [[RXN0-6274]] | |
− | == Reaction(s) | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Ec-01_007830]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4541 RXN-4541] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4542 RXN-4542] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4544 RXN-4544] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4545 RXN-4545] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-2781 PWY-2781] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-3193}} |
− | + | {{#set: common name=cis-zeatin biosynthesis}} | |
− | + | {{#set: common name=cis-cytokinins biosynthesis|tRNA-dependent cytokinin biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:15, 21 March 2018
Pathway PWY-2781
- taxonomic range:
- common name:
- cis-zeatin biosynthesis
- Synonym(s):
- cis-cytokinins biosynthesis
- tRNA-dependent cytokinin biosynthesis
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- RXN0-6274
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: