Difference between revisions of "LysW-L-glutamate"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate LysW-L-glutamate] == * common name: ** an [L-2-aminoadipate carrier protein]-L...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate LysW-L-glutamate] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an [L-2-aminoadipate carrier protein]-L-glutamate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** a [LysW protein]-L-glutamate | ||
| + | ** an [α-aminoadipate carrier protein]-L-glutamate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15005]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an [L-2-aminoadipate carrier protein]-L-glutamate}} | |
| − | + | {{#set: common name=a [LysW protein]-L-glutamate|an [α-aminoadipate carrier protein]-L-glutamate}} | |
| − | + | {{#set: consumed by=RXN-15005}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite LysW-L-glutamate
- common name:
- an [L-2-aminoadipate carrier protein]-L-glutamate
- Synonym(s):
- a [LysW protein]-L-glutamate
- an [α-aminoadipate carrier protein]-L-glutamate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an [L-2-aminoadipate carrier protein]-L-glutamate" cannot be used as a page name in this wiki.
- "a [LysW protein]-L-glutamate" cannot be used as a page name in this wiki.
- "an [α-aminoadipate carrier protein]-L-glutamate" cannot be used as a page name in this wiki.
