Difference between revisions of "PWY0-166"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166] ==
−
* smiles:
+
* taxonomic range:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** chlorophyllide a
+
** superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli)
−
* molecular weight:
+
−
** 612.967   
+
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyllide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-7676]]
+
'''14''' reactions found over '''17''' reactions in the full pathway
−
* [[RXN-13398]]
+
* [[CDPREDUCT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 7 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-19_000440]]
−
* [[RXN1F-10]]
+
*** [[Ec-06_005120]]
 +
*** [[Ec-06_005570]]
 +
*** [[Ec-21_002920]]
 +
*** [[Ec-17_003700]]
 +
*** [[Ec-11_002170]]
 +
*** [[Ec-11_002180]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DCDPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-11_005170]]
 +
*** [[Ec-26_003930]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-07_000140]]
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-11_004330]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DTDPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-26_003930]]
 +
*** [[Ec-07_000140]]
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-11_004330]]
 +
*** [[Ec-11_005170]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DTMPKI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-20_004950]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[DUDPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-07_000140]]
 +
*** [[Ec-26_003930]]
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-11_005170]]
 +
*** [[Ec-11_004330]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DUTP-PYROP-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-13_002810]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PWY-7184]]
 +
** 0 associated gene:
 +
* [[PWY-7187]]
 +
** 0 associated gene:
 +
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 +
** 5 associated gene(s):
 +
*** [[Ec-06_005570]]
 +
*** [[Ec-19_000440]]
 +
*** [[Ec-06_005120]]
 +
*** [[Ec-21_002920]]
 +
*** [[Ec-11_002170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-722]]
 +
** 5 associated gene(s):
 +
*** [[Ec-19_000440]]
 +
*** [[Ec-11_002170]]
 +
*** [[Ec-06_005570]]
 +
*** [[Ec-21_002920]]
 +
*** [[Ec-06_005120]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-723]]
 +
** 1 associated gene(s):
 +
*** [[Ec-04_006460]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-724]]
 +
** 1 associated gene(s):
 +
*** [[Ec-04_006460]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[THYMIDYLATESYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_004630]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[UDPREDUCT-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-06_005120]]
 +
*** [[Ec-21_002920]]
 +
*** [[Ec-06_005570]]
 +
*** [[Ec-11_002180]]
 +
*** [[Ec-17_003700]]
 +
*** [[Ec-11_002170]]
 +
*** [[Ec-19_000440]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DCTP-DEAM-RXN DCTP-DEAM-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 14897-06-4
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-166 PWY0-166]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368]
+
{{#set: taxonomic range=TAX-2157}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348]
+
{{#set: common name=superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli)}}
−
* LIGAND-CPD:
+
{{#set: reaction found=14}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139]
+
{{#set: total reaction=17}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: completion rate=82.0}}
−
{{#set: common name=chlorophyllide a}}
+
−
{{#set: molecular weight=612.967    }}
+
−
{{#set: common name=chlorophyllide}}
+
−
{{#set: consumed by=RXN-7676|RXN-13398}}
+
−
{{#set: reversible reaction associated=RXN1F-10}}
+

Latest revision as of 19:16, 21 March 2018

Pathway PWY0-166

  • taxonomic range:
  • common name:
    • superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli)
  • Synonym(s):

Reaction(s) found

14 reactions found over 17 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY0-166&oldid=25758"