Difference between revisions of "CDP-CHOLINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6679 PWY-6679] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2062 TAX-20...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == * smiles: ** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6679 PWY-6679] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2062 TAX-2062]
+
** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))
 +
* inchi key:
 +
** InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M
 
* common name:
 
* common name:
** jadomycin biosynthesis
+
** CDP-choline
 +
* molecular weight:
 +
** 487.319   
 
* Synonym(s):
 
* Synonym(s):
 +
** citicoline
 +
** citicholine
 +
** cidifos
 +
** cyticholine
 +
** cytidine 5'-diphosphocholine
 +
** cytidine diphosphate choline
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''9''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+
* [[2.7.7.15-RXN]]
** 7 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Ec-19_003040]]
+
* [[RXN-5781]]
*** [[Ec-03_001890]]
+
*** [[Ec-14_002460]]
+
*** [[Ec-01_009720]]
+
*** [[Ec-01_010970]]
+
*** [[Ec-19_003230]]
+
*** [[Ec-20_002520]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11975 RXN-11975]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11977 RXN-11977]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11981 RXN-11981]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11982 RXN-11982]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11983 RXN-11983]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11984 RXN-11984]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11985 RXN-11985]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11995 RXN-11995]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2062}}
+
* CAS : 987-78-0
{{#set: common name=jadomycin biosynthesis}}
+
* PUBCHEM:
{{#set: reaction found=1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202509 25202509]
{{#set: total reaction=9}}
+
* CHEBI:
{{#set: completion rate=11.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58779 58779]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00307 C00307]
 +
* HMDB : HMDB01413
 +
{{#set: smiles=C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))}}
 +
{{#set: inchi key=InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M}}
 +
{{#set: common name=CDP-choline}}
 +
{{#set: molecular weight=487.319    }}
 +
{{#set: common name=citicoline|citicholine|cidifos|cyticholine|cytidine 5'-diphosphocholine|cytidine diphosphate choline}}
 +
{{#set: produced by=2.7.7.15-RXN}}
 +
{{#set: reversible reaction associated=RXN-5781}}

Latest revision as of 19:17, 21 March 2018

Metabolite CDP-CHOLINE

  • smiles:
    • C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))
  • inchi key:
    • InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M
  • common name:
    • CDP-choline
  • molecular weight:
    • 487.319
  • Synonym(s):
    • citicoline
    • citicholine
    • cidifos
    • cyticholine
    • cytidine 5'-diphosphocholine
    • cytidine diphosphate choline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))" cannot be used as a page name in this wiki.