Difference between revisions of "CPD-207"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=B-KETOACYL-ACP B-KETOACYL-ACP] == * common name: ** a 3-oxoacyl-[acp] * Synonym(s): ** a beta-k...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] == |
| + | * smiles: | ||
| + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZIGIFDRJFZYEEQ-CECATXLMSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** phenylacetyl-CoA |
| + | * molecular weight: | ||
| + | ** 881.637 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** phenylacetate-CoA |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10821]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | * BIGG : 35419 | |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266611 45266611] |
| − | {{#set: | + | * HMDB : HMDB06503 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00582 C00582] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57390 57390] | ||
| + | * METABOLIGHTS : MTBLC57390 | ||
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=ZIGIFDRJFZYEEQ-CECATXLMSA-J}} | ||
| + | {{#set: common name=phenylacetyl-CoA}} | ||
| + | {{#set: molecular weight=881.637 }} | ||
| + | {{#set: common name=phenylacetate-CoA}} | ||
| + | {{#set: consumed by=RXN-10821}} | ||
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite CPD-207
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- inchi key:
- InChIKey=ZIGIFDRJFZYEEQ-CECATXLMSA-J
- common name:
- phenylacetyl-CoA
- molecular weight:
- 881.637
- Synonym(s):
- phenylacetate-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 35419
- PUBCHEM:
- HMDB : HMDB06503
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57390
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
