Difference between revisions of "Ec-04 005090"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
(Created page with "Category:Gene == Gene Ec-04_005090 == * left end position: ** 5131647 * transcription direction: ** NEGATIVE * right end position: ** 5139576 * centisome position: ** 78.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-04_005090 == |
− | * | + | * left end position: |
− | ** | + | ** 5131647 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5139576 |
− | * | + | * centisome position: |
− | ** | + | ** 78.80474 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0037_0085 | ||
+ | ** Esi0037_0085 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-5398]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
+ | * [[PWY-6019]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5131647}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5139576}} | |
− | + | {{#set: centisome position=78.80474 }} | |
− | + | {{#set: common name=Esi_0037_0085|Esi0037_0085}} | |
− | + | {{#set: reaction associated=RXN0-5398}} | |
− | + | {{#set: pathway associated=PWY-6019}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:17, 21 March 2018
Gene Ec-04_005090
- left end position:
- 5131647
- transcription direction:
- NEGATIVE
- right end position:
- 5139576
- centisome position:
- 78.80474
- Synonym(s):
- Esi_0037_0085
- Esi0037_0085
Reactions associated
- Reaction: RXN0-5398
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome