Difference between revisions of "RXN3O-130"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] == * smiles: ** C(C(NC(C(O)=O)[R])=O)N * common name: ** glycyl-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-130 RXN3O-130] == * direction: ** LEFT-TO-RIGHT * common name: ** Cytochrome P450 * ec number...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-130 RXN3O-130] ==
* smiles:
+
* direction:
** C(C(NC(C(O)=O)[R])=O)N
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** glycyl-peptide
+
** Cytochrome P450
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.14.13.70 EC-1.14.13.70]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 3 [[OXYGEN-MOLECULE]][c] '''+''' 3 [[NADPH]][c] '''+''' 1 [[LANOSTEROL]][c] '''+''' 2 [[PROTON]][c] '''=>''' 4 [[WATER]][c] '''+''' 1 [[FORMATE]][c] '''+''' 3 [[NADP]][c] '''+''' 1 [[44-DIMETHYL-CHOLESTA-812-24-TRIENOL]][c]
* [[2.3.1.97-RXN]]
+
* With common name(s):
 +
** 3 oxygen[c] '''+''' 3 NADPH[c] '''+''' 1 lanosterol[c] '''+''' 2 H+[c] '''=>''' 4 H2O[c] '''+''' 1 formate[c] '''+''' 3 NADP+[c] '''+''' 1 4,4-dimethyl-cholesta-8,12,24-trienol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-10_006240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6074]], zymosterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6074 PWY-6074]
 +
** '''4''' reactions found over '''12''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
* RHEA:
** [http://www.genome.jp/dbget-bin/www_bget?C02038 C02038]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25287 25287]
* CHEBI:
+
* LIGAND-RXN:
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16462 16462]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05640 R05640]
{{#set: smiles=C(C(NC(C(O)=O)[R])=O)N}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: common name=glycyl-peptide}}
+
{{#set: common name=Cytochrome P450}}
{{#set: reversible reaction associated=2.3.1.97-RXN}}
+
{{#set: ec number=EC-1.14.13.70}}
 +
{{#set: gene associated=Ec-10_006240}}
 +
{{#set: in pathway=PWY-6074}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:18, 21 March 2018

Reaction RXN3O-130

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Cytochrome P450
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6074, zymosterol biosynthesis: PWY-6074
    • 4 reactions found over 12 reactions in the full pathway

Reconstruction information

External links