Difference between revisions of "Cis-delta9-3-hydroxymontanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-5-TRISPHOSPHATE INOSITOL-1-4-5-TRISPHOSPHATE] == * smiles: ** C1(O)(C(OP([O-])([O-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta9-3-hydroxymontanoyl-ACPs cis-delta9-3-hydroxymontanoyl-ACPs] == * common name: ** a c...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-5-TRISPHOSPHATE INOSITOL-1-4-5-TRISPHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta9-3-hydroxymontanoyl-ACPs cis-delta9-3-hydroxymontanoyl-ACPs] ==
−
* smiles:
+
−
** C1(O)(C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)
+
−
* inchi key:
+
−
** InChIKey=MMWCIQZXVOZEGG-XJTPDSDZSA-H
+
 
* common name:
 
* common name:
−
** D-myo-inositol (1,4,5)-trisphosphate
+
** a cis-delta9-3-hydroxyC28:1-[acp]
−
* molecular weight:
+
−
** 414.049   
+
 
* Synonym(s):
 
* Synonym(s):
−
** inositol (1,4,5)-trisphosphate
 
−
** 1D-myo-inositol (1,4,5)-trisphosphate
 
−
** Ins(1,4,5)P3
 
−
** I(1,4,5)P3
 
−
** InsP3
 
−
** IP3
 
−
** triphosphoinositol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[3.1.3.56-RXN]]
 
−
* [[2.7.1.127-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[3.1.4.11-RXN]]
+
* [[RXN1G-240]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 85166-31-0
+
{{#set: common name=a cis-delta9-3-hydroxyC28:1-[acp]}}
−
* CAS : 88269-39-0
+
{{#set: produced by=RXN1G-240}}
−
* Wikipedia : Inositol_triphosphate
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21761708 21761708]
+
−
* HMDB : HMDB01498
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01245 C01245]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.10375590.html 10375590]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=203600 203600]
+
−
* METABOLIGHTS : MTBLC203600
+
−
{{#set: smiles=C1(O)(C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)}}
+
−
{{#set: inchi key=InChIKey=MMWCIQZXVOZEGG-XJTPDSDZSA-H}}
+
−
{{#set: common name=D-myo-inositol (1,4,5)-trisphosphate}}
+
−
{{#set: molecular weight=414.049    }}
+
−
{{#set: common name=inositol (1,4,5)-trisphosphate|1D-myo-inositol (1,4,5)-trisphosphate|Ins(1,4,5)P3|I(1,4,5)P3|InsP3|IP3|triphosphoinositol}}
+
−
{{#set: consumed by=3.1.3.56-RXN|2.7.1.127-RXN}}
+
−
{{#set: produced by=3.1.4.11-RXN}}
+

Latest revision as of 19:14, 21 March 2018

Metabolite cis-delta9-3-hydroxymontanoyl-ACPs

  • common name:
    • a cis-delta9-3-hydroxyC28:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta9-3-hydroxyC28:1-[acp" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Cis-delta9-3-hydroxymontanoyl-ACPs&oldid=25477"