Difference between revisions of "Ec-02 002430"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * smiles: ** C=C(C(=O)[O-])OC1(CC(C(=...")
(Created page with "Category:Gene == Gene Ec-02_002430 == * left end position: ** 2587903 * transcription direction: ** POSITIVE * right end position: ** 2596040 * centisome position: ** 39.6...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] ==
+
== Gene Ec-02_002430 ==
−
* smiles:
+
* left end position:
−
** C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
+
** 2587903
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 5-enolpyruvoyl-shikimate 3-phosphate
+
** 2596040
−
* molecular weight:
+
* centisome position:
−
** 320.149    
+
** 39.64439    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-enolpyruvyl-shikimate 5-phosphate
+
** Esi_0408_0002
−
** 3-enolpyruvyl-shikimate-5-P
+
** Esi0408_0002
−
** 5-O-(1-carboxyvinyl)-3-phosphoshikimate
+
** DGD
−
** 5-enolpyruvyl-shikimate 3-phosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[CHORISMATE-SYNTHASE-RXN]]
+
* Reaction: [[RXN-1225]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[2.5.1.19-RXN]]
+
== Pathways associated ==
 +
* [[PWY-401]]
 +
* [[PWY-7666]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2587903}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506801 14506801]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2596040}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57701 57701]
+
{{#set: centisome position=39.64439   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0408_0002|Esi0408_0002|DGD}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01269 C01269]
+
{{#set: reaction associated=RXN-1225}}
−
{{#set: smiles=C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)}}
+
{{#set: pathway associated=PWY-401|PWY-7666}}
−
{{#set: inchi key=InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J}}
+
−
{{#set: common name=5-enolpyruvoyl-shikimate 3-phosphate}}
+
−
{{#set: molecular weight=320.149   }}
+
−
{{#set: common name=3-enolpyruvyl-shikimate 5-phosphate|3-enolpyruvyl-shikimate-5-P|5-O-(1-carboxyvinyl)-3-phosphoshikimate|5-enolpyruvyl-shikimate 3-phosphate}}
+
−
{{#set: consumed by=CHORISMATE-SYNTHASE-RXN}}
+
−
{{#set: reversible reaction associated=2.5.1.19-RXN}}
+

Latest revision as of 19:18, 21 March 2018

Gene Ec-02_002430

  • left end position:
    • 2587903
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2596040
  • centisome position:
    • 39.64439
  • Synonym(s):
    • Esi_0408_0002
    • Esi0408_0002
    • DGD

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_002430&oldid=26013"