Difference between revisions of "TRIGLSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] == * smiles: ** CC(C(=O)C([O-])=O)(CO)C * inchi key: ** In...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-275...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C(=O)C([O-])=O)(CO)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
−
** InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 2-dehydropantoate
+
** diacylglycerol and triacylglycerol biosynthesis
−
* molecular weight:
+
−
** 145.135   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ketopantoate
+
** triglyceride biosynthesis
−
** 2-ketopantoate
+
** Kennedy pathway
 +
** TAG biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
+
'''7''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
−
* [[RXN-15635]]
+
** 6 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-05_001450]]
−
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
+
*** [[Ec-04_003220]]
 +
*** [[Ec-21_003280]]
 +
*** [[Ec-02_003060]]
 +
*** [[Ec-01_006330]]
 +
*** [[Ec-25_000060]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PHOSPHATIDATE-PHOSPHATASE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-12383]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-12959]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-1381]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_003960]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-1623]]
 +
** 4 associated gene(s):
 +
*** [[Ec-02_006160]]
 +
*** [[Ec-12_004670]]
 +
*** [[Ec-21_003240]]
 +
*** [[Ec-26_001280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-1641]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB03795
+
* ARACYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755619 16755619]
+
{{#set: taxonomic range=TAX-2759}}
−
* LIGAND-CPD:
+
{{#set: common name=diacylglycerol and triacylglycerol biosynthesis}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00966 C00966]
+
{{#set: common name=triglyceride biosynthesis|Kennedy pathway|TAG biosynthesis}}
−
* CHEMSPIDER:
+
{{#set: reaction found=7}}
−
** [http://www.chemspider.com/Chemical-Structure.14649571.html 14649571]
+
{{#set: total reaction=7}}
−
* CHEBI:
+
{{#set: completion rate=100.0}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11561 11561]
+
−
* BIGG : 36502
+
−
{{#set: smiles=CC(C(=O)C([O-])=O)(CO)C}}
+
−
{{#set: inchi key=InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M}}
+
−
{{#set: common name=2-dehydropantoate}}
+
−
{{#set: molecular weight=145.135    }}
+
−
{{#set: common name=ketopantoate|2-ketopantoate}}
+
−
{{#set: consumed by=2-DEHYDROPANTOATE-REDUCT-RXN}}
+
−
{{#set: produced by=RXN-15635}}
+
−
{{#set: reversible reaction associated=3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN}}
+

Latest revision as of 19:18, 21 March 2018

Pathway TRIGLSYN-PWY

  • taxonomic range:
  • common name:
    • diacylglycerol and triacylglycerol biosynthesis
  • Synonym(s):
    • triglyceride biosynthesis
    • Kennedy pathway
    • TAG biosynthesis

Reaction(s) found

7 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TRIGLSYN-PWY&oldid=26028"