Difference between revisions of "Ec-21 001990"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C=CC(O)=CC=1))COP...")
 
(Created page with "Category:Gene == Gene Ec-21_001990 == * left end position: ** 3036840 * transcription direction: ** NEGATIVE * right end position: ** 3049270 * centisome position: ** 41.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] ==
+
== Gene Ec-21_001990 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** 3036840
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OVQOJJJXNYHOPR-FUEUKBNZSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4-hydroxybenzoyl-acetyl-CoA
+
** 3049270
−
* molecular weight:
+
* centisome position:
−
** 925.647    
+
** 41.14893    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(4-hydroxyphenyl)-3-oxo-propanoyl-CoA
+
** Esi_0150_0079
−
** 3-(4-hydroxyphenyl)-3-keto-propanoyl-CoA
+
** Esi0150_0079
−
** 3-(4-hydroxyphenyl)-3-keto-propionyl-CoA
+
−
** 3-(4-hydroxyphenyl)-3-oxo-propionyl-CoA
+
−
** p-hydroxybenzoyl-acetyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GALACTONOLACTONASE-RXN]]
−
* [[RXN-11245]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[GLUCONOLACT-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-11152]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-8783]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-2221]]
 +
* [[PWY-6415]]
 +
* [[PWY-7165]]
 +
* [[NPGLUCAT-PWY]]
 +
* [[GLUCOSE1PMETAB-PWY]]
 +
* [[PWY3DJ-35471]]
 +
* [[GALDEG-PWY]]
 +
* [[PWY-5530]]
 +
* [[DHGLUCONATE-PYR-CAT-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3036840}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200630 25200630]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: right end position=3049270}}
−
{{#set: inchi key=InChIKey=OVQOJJJXNYHOPR-FUEUKBNZSA-J}}
+
{{#set: centisome position=41.14893   }}
−
{{#set: common name=4-hydroxybenzoyl-acetyl-CoA}}
+
{{#set: common name=Esi_0150_0079|Esi0150_0079}}
−
{{#set: molecular weight=925.647   }}
+
{{#set: reaction associated=GALACTONOLACTONASE-RXN|GLUCONOLACT-RXN|RXN-11152|RXN-8783}}
−
{{#set: common name=3-(4-hydroxyphenyl)-3-oxo-propanoyl-CoA|3-(4-hydroxyphenyl)-3-keto-propanoyl-CoA|3-(4-hydroxyphenyl)-3-keto-propionyl-CoA|3-(4-hydroxyphenyl)-3-oxo-propionyl-CoA|p-hydroxybenzoyl-acetyl-CoA}}
+
{{#set: pathway associated=PWY-2221|PWY-6415|PWY-7165|NPGLUCAT-PWY|GLUCOSE1PMETAB-PWY|PWY3DJ-35471|GALDEG-PWY|PWY-5530|DHGLUCONATE-PYR-CAT-PWY}}
−
{{#set: produced by=RXN-11245}}
+

Latest revision as of 19:14, 21 March 2018

Gene Ec-21_001990

  • left end position:
    • 3036840
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3049270
  • centisome position:
    • 41.14893
  • Synonym(s):
    • Esi_0150_0079
    • Esi0150_0079

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_001990&oldid=25484"