Difference between revisions of "PWY-5386"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5386 PWY-5386] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5386 PWY-5386] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** 4α-carboxy-5α-cholesta-8-en-3β-ol
+
** methylglyoxal degradation I
* molecular weight:
+
** 429.662   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-23]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GLYOXI-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-09_000050]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GLYOXII-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-06_010680]]
 +
*** [[Ec-04_001020]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DLACTDEHYDROGFAD-RXN DLACTDEHYDROGFAD-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200717 25200717]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5386 PWY-5386]
* HMDB : HMDB12166
+
{{#set: taxonomic range=TAX-33208}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: taxonomic range=TAX-4751}}
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
+
{{#set: common name=methylglyoxal degradation I}}
{{#set: molecular weight=429.662    }}
+
{{#set: reaction found=2}}
{{#set: consumed by=RXN66-23}}
+
{{#set: total reaction=3}}
 +
{{#set: completion rate=67.0}}

Latest revision as of 20:19, 21 March 2018

Pathway PWY-5386

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links