Difference between revisions of "RXN-7741"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == * smiles: ** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-])) * in...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7741 RXN-7741] == * direction: ** LEFT-TO-RIGHT * common name: ** Red chlorophyll catabolite re...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7741 RXN-7741] ==
−
* smiles:
+
* direction:
−
** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M
+
 
* common name:
 
* common name:
−
** cyclic-GMP
+
** Red chlorophyll catabolite reductase
−
* molecular weight:
+
* ec number:
−
** 344.2   
+
** [http://enzyme.expasy.org/EC/1.3.7.12 EC-1.3.7.12]
 
* Synonym(s):
 
* Synonym(s):
−
** 3',5'-cyclic GMP
 
−
** guanosine-cyclic-phosphoric-acid
 
−
** cGMP
 
−
** guanosine cyclic-monophosphate
 
−
** guanosine 3',5'-cyclic-monophosphate
 
−
** guanosine 3',5'-cyclic phosphate
 
−
** cyclic 3',5'-guanosine monophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 2 [[Reduced-ferredoxins]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[CPD-7063]][c] '''=>''' 2 [[Oxidized-ferredoxins]][c] '''+''' 1 [[CPD-7064]][c]
−
* [[GUANYLCYC-RXN]]
+
* With common name(s):
 +
** 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 2 H+[c] '''+''' 1 red chlorophyll catabolite[c] '''=>''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 primary fluorescent chlorophyll catabolite[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-18_003740]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-5098]], chlorophyll a degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5098 PWY-5098]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-6927]], chlorophyll a degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6927 PWY-6927]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 7665-99-8
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24755 24755]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16727415 16727415]
+
* LIGAND-RXN:
−
* HMDB : HMDB01314
+
** [http://www.genome.jp/dbget-bin/www_bget?R09032 R09032]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00942 C00942]
+
{{#set: common name=Red chlorophyll catabolite reductase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-1.3.7.12}}
−
** [http://www.chemspider.com/Chemical-Structure.20559156.html 20559156]
+
{{#set: gene associated=Ec-18_003740}}
−
* CHEBI:
+
{{#set: in pathway=PWY-5098|PWY-6927}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57746 57746]
+
{{#set: reconstruction category=annotation}}
−
* METABOLIGHTS : MTBLC57746
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M}}
+
−
{{#set: common name=cyclic-GMP}}
+
−
{{#set: molecular weight=344.2    }}
+
−
{{#set: common name=3',5'-cyclic GMP|guanosine-cyclic-phosphoric-acid|cGMP|guanosine cyclic-monophosphate|guanosine 3',5'-cyclic-monophosphate|guanosine 3',5'-cyclic phosphate|cyclic 3',5'-guanosine monophosphate}}
+
−
{{#set: reversible reaction associated=GUANYLCYC-RXN}}
+

Latest revision as of 19:19, 21 March 2018

Reaction RXN-7741

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Red chlorophyll catabolite reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 a reduced ferredoxin [iron-sulfur] cluster[c] + 2 H+[c] + 1 red chlorophyll catabolite[c] => 2 an oxidized ferredoxin [iron-sulfur] cluster[c] + 1 primary fluorescent chlorophyll catabolite[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5098, chlorophyll a degradation I: PWY-5098
    • 3 reactions found over 6 reactions in the full pathway
  • PWY-6927, chlorophyll a degradation II: PWY-6927
    • 3 reactions found over 5 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-7741&oldid=26104"