Difference between revisions of "RXN-7741"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == * smiles: ** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-])) * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7741 RXN-7741] == * direction: ** LEFT-TO-RIGHT * common name: ** Red chlorophyll catabolite re...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7741 RXN-7741] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Red chlorophyll catabolite reductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.7.12 EC-1.3.7.12] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 2 [[Reduced-ferredoxins]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[CPD-7063]][c] '''=>''' 2 [[Oxidized-ferredoxins]][c] '''+''' 1 [[CPD-7064]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 2 H+[c] '''+''' 1 red chlorophyll catabolite[c] '''=>''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 primary fluorescent chlorophyll catabolite[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-18_003740]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-5098]], chlorophyll a degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5098 PWY-5098] | ||
+ | ** '''3''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-6927]], chlorophyll a degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6927 PWY-6927] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24755 24755] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R09032 R09032] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=Red chlorophyll catabolite reductase}} |
− | + | {{#set: ec number=EC-1.3.7.12}} | |
− | + | {{#set: gene associated=Ec-18_003740}} | |
− | + | {{#set: in pathway=PWY-5098|PWY-6927}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:19, 21 March 2018
Contents
Reaction RXN-7741
- direction:
- LEFT-TO-RIGHT
- common name:
- Red chlorophyll catabolite reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 Reduced-ferredoxins[c] + 2 PROTON[c] + 1 CPD-7063[c] => 2 Oxidized-ferredoxins[c] + 1 CPD-7064[c]
- With common name(s):
- 2 a reduced ferredoxin [iron-sulfur] cluster[c] + 2 H+[c] + 1 red chlorophyll catabolite[c] => 2 an oxidized ferredoxin [iron-sulfur] cluster[c] + 1 primary fluorescent chlorophyll catabolite[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-18_003740
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5098, chlorophyll a degradation I: PWY-5098
- 3 reactions found over 6 reactions in the full pathway
- PWY-6927, chlorophyll a degradation II: PWY-6927
- 3 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links