Difference between revisions of "CPD-12179"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12179 CPD-12179] == * common name: ** methylmalonate semialdehyde * Synonym(s): ** 2-methyl...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12179 CPD-12179] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** methylmalonate semialdehyde |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-methyl-3-oxopropanoate |
| + | ** CH3-malonate-semialdehyde | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.2.1.27-RXN]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=methylmalonate semialdehyde}} | |
| − | + | {{#set: common name=2-methyl-3-oxopropanoate|CH3-malonate-semialdehyde}} | |
| − | + | {{#set: consumed by=1.2.1.27-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite CPD-12179
- common name:
- methylmalonate semialdehyde
- Synonym(s):
- 2-methyl-3-oxopropanoate
- CH3-malonate-semialdehyde
