Difference between revisions of "Ec-24 003570"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)N(C)C(=O)N2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-24_003570 == * left end position: ** 3876603 * transcription direction: ** POSITIVE * right end position: ** 3887334 * centisome position: ** 77.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_003570 == |
− | * | + | * left end position: |
− | ** | + | ** 3876603 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3887334 |
− | * | + | * centisome position: |
− | ** | + | ** 77.723694 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0034_0064 |
+ | ** Esi0034_0064 | ||
+ | ** TOP6A | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[5.99.1.2-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[5.99.1.3-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3876603}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3887334}} | |
− | + | {{#set: centisome position=77.723694 }} | |
− | + | {{#set: common name=Esi_0034_0064|Esi0034_0064|TOP6A}} | |
− | + | {{#set: reaction associated=5.99.1.2-RXN|5.99.1.3-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:19, 21 March 2018
Gene Ec-24_003570
- left end position:
- 3876603
- transcription direction:
- POSITIVE
- right end position:
- 3887334
- centisome position:
- 77.723694
- Synonym(s):
- Esi_0034_0064
- Esi0034_0064
- TOP6A
Reactions associated
- Reaction: 5.99.1.2-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: 5.99.1.3-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome