Difference between revisions of "PWY-5855"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5855 PWY-5855] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5855 PWY-5855] ==
−
* smiles:
+
* taxonomic range:
−
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L
+
 
* common name:
 
* common name:
−
** dGMP
+
** ubiquinol-7 biosynthesis (prokaryotic)
−
* molecular weight:
+
−
** 345.208   
+
 
* Synonym(s):
 
* Synonym(s):
−
** G
+
** ubiquinone-7 biosynthesis (prokaryotic)
−
** 2'-dG-5'-MP
+
−
** 2'-deoxyguanosine 5'-monophosphate
+
−
** guanine riboside
+
−
** vernine
+
−
** 2'-deoxyguanosine 5'-phosphate
+
−
** deoxyguanosine-phosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''8''' reactions in the full pathway
−
* [[RXN-14208]]
+
* [[RXN-9222]]
−
* [[RXN0-385]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-00_007360]]
−
* [[RXN-14218]]
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9223 RXN-9223]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9224 RXN-9224]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9225 RXN-9225]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9226 RXN-9226]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9227 RXN-9227]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9228 RXN-9228]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9229 RXN-9229]
 
== External links  ==
 
== External links  ==
−
* CAS : 902-04-5
+
{{#set: taxonomic range=TAX-2}}
−
* BIGG : 34744
+
{{#set: common name=ubiquinol-7 biosynthesis (prokaryotic)}}
−
* PUBCHEM:
+
{{#set: common name=ubiquinone-7 biosynthesis (prokaryotic)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6994968 6994968]
+
{{#set: reaction found=1}}
−
* HMDB : HMDB01044
+
{{#set: total reaction=8}}
−
* LIGAND-CPD:
+
{{#set: completion rate=13.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00362 C00362]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5362940.html 5362940]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57673 57673]
+
−
* METABOLIGHTS : MTBLC57673
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L}}
+
−
{{#set: common name=dGMP}}
+
−
{{#set: molecular weight=345.208    }}
+
−
{{#set: common name=G|2'-dG-5'-MP|2'-deoxyguanosine 5'-monophosphate|guanine riboside|vernine|2'-deoxyguanosine 5'-phosphate|deoxyguanosine-phosphate}}
+
−
{{#set: produced by=RXN-14208|RXN0-385}}
+
−
{{#set: reversible reaction associated=RXN-14218}}
+

Latest revision as of 19:19, 21 March 2018

Pathway PWY-5855

  • taxonomic range:
  • common name:
    • ubiquinol-7 biosynthesis (prokaryotic)
  • Synonym(s):
    • ubiquinone-7 biosynthesis (prokaryotic)

Reaction(s) found

1 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5855&oldid=26154"