Difference between revisions of "1516-DIHYDROBILIVERDIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6601 RXN-6601] == * direction: ** LEFT-TO-RIGHT * common name: ** Gamma-glutamyltranspeptidase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6601 RXN-6601] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
 +
* inchi key:
 +
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
 
* common name:
 
* common name:
−
** Gamma-glutamyltranspeptidase
+
** 15,16-dihydrobiliverdin
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2]
+
** 582.655   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[1.3.7.3-RXN]]
−
** 1 [[GLUTATHIONE]][c] '''+''' 1 [[Amino-Acids-20]][c] '''=>''' 1 [[5-L-GLUTAMYL-L-AMINO-ACID]][c] '''+''' 1 [[CYS-GLY]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 glutathione[c] '''+''' 1 a standard α amino acid[c] '''=>''' 1 an (γ-L-glutamyl)-L-amino acid[c] '''+''' 1 L-cysteinyl-glycine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-21_006220]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-4041]], γ-glutamyl cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041]
+
−
** '''5''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Gamma-glutamyltranspeptidase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
−
{{#set: ec number=EC-2.3.2.2}}
+
* CHEBI:
−
{{#set: gene associated=Ec-21_006220}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
−
{{#set: in pathway=PWY-4041}}
+
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=15,16-dihydrobiliverdin}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=582.655    }}
 +
{{#set: consumed by=1.3.7.3-RXN}}

Latest revision as of 19:20, 21 March 2018

Metabolite 1516-DIHYDROBILIVERDIN

  • smiles:
    • C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
  • inchi key:
    • InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
  • common name:
    • 15,16-dihydrobiliverdin
  • molecular weight:
    • 582.655
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=1516-DIHYDROBILIVERDIN&oldid=26190"