Difference between revisions of "CPD-18353"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18353 CPD-18353] == * smiles: ** CCCCCCC=CCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCC=CCCCCCC)COP([O-])...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18353 CPD-18353] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCC=CCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCC=CCCCCCC)COP([O-])(=O)[O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=LMYYBYHAZAFVTR-YKEOXISKSA-L |
* common name: | * common name: | ||
− | ** | + | ** 1,2-dicis-vaccenoyl-phosphatidate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 698.959 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 18:1-18:1-PA |
− | + | ** 1,2-(11Z-octadecenoyl)-sn-glycerol-3-phosphate | |
− | ** 2- | + | ** 1,2-dicis-vaccenoyl phosphatidate |
− | + | ||
− | + | ||
− | + | ||
− | ** | + | |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17011]] |
+ | * [[RXN-17015]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: smiles=CCCCCCC=CCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCC=CCCCCCC)COP([O-])(=O)[O-])=O}} | |
− | + | {{#set: inchi key=InChIKey=LMYYBYHAZAFVTR-YKEOXISKSA-L}} | |
− | + | {{#set: common name=1,2-dicis-vaccenoyl-phosphatidate}} | |
− | + | {{#set: molecular weight=698.959 }} | |
− | + | {{#set: common name=18:1-18:1-PA|1,2-(11Z-octadecenoyl)-sn-glycerol-3-phosphate|1,2-dicis-vaccenoyl phosphatidate}} | |
− | + | {{#set: produced by=RXN-17011|RXN-17015}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite CPD-18353
- smiles:
- CCCCCCC=CCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCC=CCCCCCC)COP([O-])(=O)[O-])=O
- inchi key:
- InChIKey=LMYYBYHAZAFVTR-YKEOXISKSA-L
- common name:
- 1,2-dicis-vaccenoyl-phosphatidate
- molecular weight:
- 698.959
- Synonym(s):
- 18:1-18:1-PA
- 1,2-(11Z-octadecenoyl)-sn-glycerol-3-phosphate
- 1,2-dicis-vaccenoyl phosphatidate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCC=CCCCCCC)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.