Difference between revisions of "CPD0-2352"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2352 CPD0-2352] == * common name: ** a tRNA precursor with a 5' extension and a short 3' e...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2352 CPD0-2352] ==
* smiles:
+
** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
+
* inchi key:
+
** InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
+
 
* common name:
 
* common name:
** D-galactono-1,4-lactone
+
** a tRNA precursor with a 5' extension and a short 3' extension
* molecular weight:
+
** 178.141   
+
 
* Synonym(s):
 
* Synonym(s):
** D-galactonate-γ-lactone
 
** galactono-γ-lactone
 
** D-galactonolactone
 
** D-galactono-γ-lactone
 
** D-galactonic acid γ-lactone
 
** γ-D-galactonolactone
 
** D-(-)-galactonic acid γ-lactone
 
** D-galactonic acid g-lactone
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GALACTONOLACTONASE-RXN]]
+
* [[3.1.26.5-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 2782-07-2
+
{{#set: common name=a tRNA precursor with a 5' extension and a short 3' extension}}
* PUBCHEM:
+
{{#set: consumed by=3.1.26.5-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=97165 97165]
+
* HMDB : HMDB02541
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03383 C03383]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.92162.html 92162]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15895 15895]
+
{{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}}
+
{{#set: inchi key=InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N}}
+
{{#set: common name=D-galactono-1,4-lactone}}
+
{{#set: molecular weight=178.141    }}
+
{{#set: common name=D-galactonate-γ-lactone|galactono-γ-lactone|D-galactonolactone|D-galactono-γ-lactone|D-galactonic acid γ-lactone|γ-D-galactonolactone|D-(-)-galactonic acid γ-lactone|D-galactonic acid g-lactone}}
+
{{#set: consumed by=GALACTONOLACTONASE-RXN}}
+

Latest revision as of 19:21, 21 March 2018

Metabolite CPD0-2352

  • common name:
    • a tRNA precursor with a 5' extension and a short 3' extension
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links