Difference between revisions of "PWY-6554"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17365 CPD-17365] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17365 CPD-17365] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554] ==
* smiles:
+
* taxonomic range:
** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=QKBTYZDPVNTERQ-UWVCYPHHSA-J
+
 
* common name:
 
* common name:
** (4Z,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA
+
** 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3)
* molecular weight:
+
** 1075.997   
+
 
* Synonym(s):
 
* Synonym(s):
** (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyl-Coa
+
** phytate biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''5''' reactions in the full pathway
* [[RXN-17116]]
+
* [[2.7.1.133-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-05_003010]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[2.7.1.139-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-05_003010]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[2.7.1.140-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-7163]]
 +
** 2 associated gene(s):
 +
*** [[Ec-16_003350]]
 +
*** [[Ec-18_000620]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7184 RXN-7184]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193701 72193701]
+
{{#set: common name=1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3)}}
* CHEBI:
+
{{#set: common name=phytate biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76368 76368]
+
{{#set: reaction found=4}}
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: total reaction=5}}
{{#set: inchi key=InChIKey=QKBTYZDPVNTERQ-UWVCYPHHSA-J}}
+
{{#set: completion rate=80.0}}
{{#set: common name=(4Z,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA}}
+
{{#set: molecular weight=1075.997    }}
+
{{#set: common name=(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyl-Coa}}
+
{{#set: produced by=RXN-17116}}
+

Latest revision as of 19:14, 21 March 2018

Pathway PWY-6554

  • taxonomic range:
  • common name:
    • 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3)
  • Synonym(s):
    • phytate biosynthesis

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links