Difference between revisions of "CPD-8613"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P562-PWY P562-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P562-PWY P562-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
 +
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
 
* common name:
 
* common name:
** myo-inositol degradation I
+
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
 +
* molecular weight:
 +
** 443.688   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''7''' reactions in the full pathway
+
* [[RXN66-18]]
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** 3 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Ec-07_006540]]
+
*** [[Ec-01_006070]]
+
*** [[Ec-18_003270]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[RXN-2902]]
+
** 2 associated gene(s):
+
*** [[Ec-10_003810]]
+
*** [[Ec-06_003440]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=4.1.2.29-RXN 4.1.2.29-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=5-DEHYDRO-2-DEOXYGLUCONOKINASE-RXN 5-DEHYDRO-2-DEOXYGLUCONOKINASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSOSE-2-DEHYDRATASE-RXN MYO-INOSOSE-2-DEHYDRATASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14149 RXN-14149]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14150 RXN-14150]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202943 25202943]
{{#set: common name=myo-inositol degradation I}}
+
* HMDB : HMDB12165
{{#set: reaction found=2}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
{{#set: total reaction=7}}
+
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
{{#set: completion rate=29.0}}
+
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: molecular weight=443.688    }}
 +
{{#set: consumed by=RXN66-18}}

Latest revision as of 19:21, 21 March 2018

Metabolite CPD-8613

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
  • common name:
    • 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
  • molecular weight:
    • 443.688
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.