Difference between revisions of "RXN-15889"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15889 RXN-15889] == * direction: ** LEFT-TO-RIGHT * common name: ** holo-[acyl-carrier-protein]...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15889 RXN-15889] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
+
 
* common name:
 
* common name:
−
** 1-18:1-2-lysophosphatidylethanolamine
+
** holo-[acyl-carrier-protein] synthase
−
* molecular weight:
+
* ec number:
−
** 479.593   
+
** [http://enzyme.expasy.org/EC/2.7.8.7 EC-2.7.8.7]
 
* Synonym(s):
 
* Synonym(s):
−
** 1-18:1-lysoPE
 
−
** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-15035]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CO-A]][c] '''+''' 1 [[Apo-EntF]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c] '''+''' 1 [[Holo-EntF]][c]
−
* [[RXN-15067]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 coenzyme A[c] '''+''' 1 an apo-[EntF peptidyl-carrier protein][c] '''=>''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 a holo-[EntF peptidyl-carrier protein][c]
−
* [[RXN-15036]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_000130]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_004620]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[ENTBACSYN-PWY]], enterobactin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=ENTBACSYN-PWY ENTBACSYN-PWY]
 +
** '''3''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=58177709 58177709]
+
{{#set: common name=holo-[acyl-carrier-protein] synthase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.7.8.7}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971]
+
{{#set: gene associated=Ec-01_000130|Ec-06_004620}}
−
* HMDB : HMDB11506
+
{{#set: in pathway=ENTBACSYN-PWY}}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=1-18:1-2-lysophosphatidylethanolamine}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=479.593    }}
+
−
{{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
+
−
{{#set: consumed by=RXN-15035}}
+
−
{{#set: produced by=RXN-15067}}
+
−
{{#set: reversible reaction associated=RXN-15036}}
+

Latest revision as of 19:22, 21 March 2018

Reaction RXN-15889

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • holo-[acyl-carrier-protein] synthase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 an apo-[EntF peptidyl-carrier protein][c] => 1 H+[c] + 1 adenosine 3',5'-bisphosphate[c] + 1 a holo-[EntF peptidyl-carrier protein][c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"holo-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15889&oldid=26403"