Difference between revisions of "CPD0-2189"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUGLNSYN-PWY GLUGLNSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * smiles: ** C(O)C(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=JBNUARFQ...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUGLNSYN-PWY GLUGLNSYN-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C(O)C(O)C([N+])C(=O)[O-]
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
* inchi key:
 +
** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
 
* common name:
 
* common name:
−
** L-glutamate biosynthesis IV
+
** 4-hydroxy-L-threonine
 +
* molecular weight:
 +
** 135.119   
 
* Synonym(s):
 
* Synonym(s):
−
** L-glutamate biosynthesis from L-glutamine
+
** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
 +
** hydroxythreonine
 +
** 3-hydroxyhomoserine
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
+
* [[RXN-14125]]
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-26_004630]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33090}}
+
* CAS : 21768-45-6
−
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
−
{{#set: common name=L-glutamate biosynthesis IV}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420]
−
{{#set: common name=L-glutamate biosynthesis from L-glutamine}}
+
* LIGAND-CPD:
−
{{#set: reaction found=1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056]
−
{{#set: total reaction=1}}
+
* CHEMSPIDER:
−
{{#set: completion rate=100.0}}
+
** [http://www.chemspider.com/Chemical-Structure.167988.html 167988]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904]
 +
* BIGG : 1450010
 +
{{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}}
 +
{{#set: common name=4-hydroxy-L-threonine}}
 +
{{#set: molecular weight=135.119    }}
 +
{{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}}
 +
{{#set: produced by=RXN-14125}}

Latest revision as of 19:24, 21 March 2018

Metabolite CPD0-2189

  • smiles:
    • C(O)C(O)C([N+])C(=O)[O-]
  • inchi key:
    • InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
  • common name:
    • 4-hydroxy-L-threonine
  • molecular weight:
    • 135.119
  • Synonym(s):
    • (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
    • hydroxythreonine
    • 3-hydroxyhomoserine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-2189&oldid=26623"