Difference between revisions of "Ec-01 004650"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Ec-01_004650 == * left end position: ** 3979077 * transcription direction: ** NEGATIVE * right end position: ** 3984941 * centisome position: ** 38.5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_004650 == |
− | * | + | * left end position: |
− | ** | + | ** 3979077 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3984941 |
− | * | + | * centisome position: |
− | ** | + | ** 38.561306 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0018_0180 |
+ | ** Esi0018_0180 | ||
+ | ** TUB | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-5462]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3979077}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3984941}} | |
− | + | {{#set: centisome position=38.561306 }} | |
− | + | {{#set: common name=Esi_0018_0180|Esi0018_0180|TUB}} | |
− | + | {{#set: reaction associated=RXN0-5462}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Gene Ec-01_004650
- left end position:
- 3979077
- transcription direction:
- NEGATIVE
- right end position:
- 3984941
- centisome position:
- 38.561306
- Synonym(s):
- Esi_0018_0180
- Esi0018_0180
- TUB
Reactions associated
- Reaction: RXN0-5462
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome