Difference between revisions of "Ec-01 004650"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * inchi key: ** InCh...")
 
(Created page with "Category:Gene == Gene Ec-01_004650 == * left end position: ** 3979077 * transcription direction: ** NEGATIVE * right end position: ** 3984941 * centisome position: ** 38.5...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] ==
+
== Gene Ec-01_004650 ==
−
* smiles:
+
* left end position:
−
** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C
+
** 3979077
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** pristanate
+
** 3984941
−
* molecular weight:
+
* centisome position:
−
** 297.5    
+
** 38.561306    
 
* Synonym(s):
 
* Synonym(s):
−
** pristanic-acid
+
** Esi_0018_0180
 +
** Esi0018_0180
 +
** TUB
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-484]]
+
* Reaction: [[RXN0-5462]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3979077}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849056 20849056]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=3984941}}
−
** [http://www.chemspider.com/Chemical-Structure.20171482.html 20171482]
+
{{#set: centisome position=38.561306   }}
−
* CHEBI:
+
{{#set: common name=Esi_0018_0180|Esi0018_0180|TUB}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77268 77268]
+
{{#set: reaction associated=RXN0-5462}}
−
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C}}
+
−
{{#set: inchi key=InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M}}
+
−
{{#set: common name=pristanate}}
+
−
{{#set: molecular weight=297.5   }}
+
−
{{#set: common name=pristanic-acid}}
+
−
{{#set: consumed by=RXN66-484}}
+

Latest revision as of 19:14, 21 March 2018

Gene Ec-01_004650

  • left end position:
    • 3979077
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3984941
  • centisome position:
    • 38.561306
  • Synonym(s):
    • Esi_0018_0180
    • Esi0018_0180
    • TUB

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_004650&oldid=25558"