Difference between revisions of "CPD-8652"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_005940 == * left end position: ** 5393603 * transcription direction: ** POSITIVE * right end position: ** 5398798 * centisome position: ** 64.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M |
| − | * | + | * common name: |
| − | ** | + | ** leucodopachrome |
| − | * | + | * molecular weight: |
| − | ** | + | ** 194.166 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** cyclo-dopa |
| − | ** | + | ** 2-carboxy-2,3-dihydro-5,6-dihydroxyindole |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-11369]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-8483]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202233 25202233] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05604 C05604] |
| − | {{#set: common name= | + | * HMDB : HMDB04067 |
| − | {{#set: | + | {{#set: smiles=C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))}} |
| + | {{#set: inchi key=InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M}} | ||
| + | {{#set: common name=leucodopachrome}} | ||
| + | {{#set: molecular weight=194.166 }} | ||
| + | {{#set: common name=cyclo-dopa|2-carboxy-2,3-dihydro-5,6-dihydroxyindole}} | ||
| + | {{#set: consumed by=RXN-11369}} | ||
| + | {{#set: produced by=RXN-8483}} | ||
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite CPD-8652
- smiles:
- C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
- inchi key:
- InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
- common name:
- leucodopachrome
- molecular weight:
- 194.166
- Synonym(s):
- cyclo-dopa
- 2-carboxy-2,3-dihydro-5,6-dihydroxyindole
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))" cannot be used as a page name in this wiki.
