Difference between revisions of "Long-Chain-Acyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Acyl-ACPs Long-Chain-Acyl-ACPs] == * common name: ** a long-chain acyl-[acyl-carrier...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Acyl-ACPs Long-Chain-Acyl-ACPs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a long-chain acyl-[acyl-carrier protein] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** a long-chain acyl-[acp] | ||
+ | ** a fatty acyl-[acp] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-16067]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a long-chain acyl-[acyl-carrier protein]}} | |
− | + | {{#set: common name=a long-chain acyl-[acp]|a fatty acyl-[acp]}} | |
− | + | {{#set: consumed by=RXN-16067}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 19:27, 21 March 2018
Contents
Metabolite Long-Chain-Acyl-ACPs
- common name:
- a long-chain acyl-[acyl-carrier protein]
- Synonym(s):
- a long-chain acyl-[acp]
- a fatty acyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a long-chain acyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
- "a long-chain acyl-[acp" cannot be used as a page name in this wiki.
- "a fatty acyl-[acp" cannot be used as a page name in this wiki.